Citation: Wang, Chih-Min; Chiu, Cheng-Wei; Lin, Hsiu-Mei; Lii, Kwang-Hwa (2013). Synthesis, characterization, and properties of the first indium borogermanate incorporating an organic amine ligand: InBGe2O6(OH)2(CH3CH(NH2)CH2NH2)·2H2O. Journal of Solid State Chemistry, 208, pp. 116-119.
Formula: C3 H16 B Ge2 In N2 O10
Cell parameters:
a = 6.9459(9) Å
b = 8.8360(12) Å
c = 11.0226(16) Å
α = 85.958(9)°
β = 87.853(9)°
γ = 79.441(8)°
List type: noninterleaving
List: 2D
Combined 3D structure and graph
span 1{1 1 1}
Ctrl-click to select multiple nodes
JSmol combined CIF view
Linear Graph Knot
Molecules
CIF datablock 0, entity 1 of 1
Basis: (1;0;0 0;1;0)
Dimensionality: 2
Formula: C6 H24 B2 Ge4 In2 N4 O16 (C3 H12 B Ge2 In N2 O8)