Structure 1563514

1563513 << 1563514 >> 1563515

Citation: Pizon, David; Henry, Natacha; Loiseau, Thierry; Roussel, Pascal; Abraham, Francis (2010). Synthesis, crystal structure and thermal behavior of two hydrated forms of lanthanide phthalates Ln2(O2+C6H4--CO2)3(H2O) (Ln=Ce, Nd) and Nd2(O2C--C6H4--CO2)3(H2O)3. Journal of Solid State Chemistry, 183, pp. 1943-1948.

Formula: C24 H12 Nd2 O13

Cell parameters:

a = 27.5346(3) Å
b = 11.3006(2) Å
c = 15.5119(3) Å

α = 90°
β = 90°
γ = 90°

List type: interleaving

List: 2D

Molecules

CIF datablock 0, entity 1 of 2

Basis: (0;1;0 0;0;1)

Dimensionality: 2

Formula: C96 H48 Nd8 O52 (C24 H12 Nd2 O13)

Multiplicity: 1

Coordination sequences:

1, 2, 4, 3, 3, 4, 12, 20, 39, 52
1, 2, 4, 3, 3, 4, 16, 22, 39, 60
1, 2, 4, 3, 3, 4, 16, 27, 33, 46
1, 2, 4, 3, 3, 4, 18, 34, 40, 67
1, 2, 4, 3, 3, 5, 20, 27, 34, 45
1, 2, 4, 3, 3, 5, 21, 27, 43, 62
1, 2, 4, 5, 5, 12, 20, 39, 52, 80
1, 2, 4, 5, 5, 16, 22, 39, 60, 75
1, 2, 4, 5, 5, 16, 27, 33, 46, 79
1, 2, 4, 5, 5, 18, 34, 40, 67, 84
1, 2, 4, 5, 6, 20, 27, 34, 45, 93
1, 2, 4, 5, 6, 21, 27, 43, 62, 93
1, 8, 14, 24, 33, 54, 72, 84, 100, 109
2, 10, 14, 25, 36, 50, 69, 88, 96, 110
2, 10, 14, 26, 36, 49, 69, 88, 96, 110
2, 10, 16, 30, 34, 59, 71, 92, 105, 117
2, 10, 16, 32, 44, 60, 84, 99, 120, 134
2, 10, 16, 34, 44, 60, 83, 98, 120, 134
2, 11, 15, 28, 35, 57, 74, 97, 100, 121
2, 11, 15, 30, 47, 60, 83, 103, 117, 132
2, 11, 15, 32, 46, 61, 82, 102, 117, 132
3, 4, 3, 3, 4, 12, 20, 39, 52, 80
3, 4, 3, 3, 4, 16, 22, 39, 60, 75
3, 4, 3, 3, 4, 16, 27, 33, 46, 79
3, 4, 3, 3, 4, 18, 34, 40, 67, 84
3, 4, 3, 3, 5, 20, 27, 34, 45, 93
3, 4, 3, 3, 5, 21, 27, 43, 62, 93
3, 4, 5, 5, 12, 20, 39, 52, 80, 95
3, 4, 5, 5, 16, 22, 39, 60, 75, 102
3, 4, 5, 5, 16, 27, 33, 46, 79, 114
3, 4, 5, 5, 18, 34, 40, 67, 84, 122
3, 4, 5, 6, 20, 27, 34, 45, 93, 110
3, 4, 5, 6, 21, 27, 43, 62, 93, 111
3, 4, 16, 15, 31, 42, 64, 83, 98, 108
3, 4, 20, 24, 25, 41, 71, 93, 91, 107
3, 4, 21, 26, 40, 60, 75, 102, 128, 130
3, 4, 21, 27, 39, 60, 75, 102, 128, 130
3, 5, 24, 24, 34, 43, 85, 99, 97, 115
3, 5, 25, 23, 34, 51, 86, 99, 107, 117
3, 6, 7, 13, 20, 39, 52, 80, 95, 119
3, 6, 7, 17, 22, 39, 60, 75, 102, 128
3, 6, 7, 17, 27, 33, 46, 79, 114, 111
3, 6, 7, 19, 34, 40, 67, 84, 122, 133
3, 6, 8, 21, 27, 34, 45, 93, 110, 105
3, 6, 8, 22, 27, 43, 62, 93, 111, 123
3, 14, 14, 33, 38, 63, 78, 95, 104, 114
3, 15, 14, 32, 38, 63, 78, 95, 104, 114
3, 15, 14, 34, 38, 64, 82, 95, 104, 119
3, 18, 23, 28, 44, 72, 93, 91, 107, 127
9, 14, 24, 33, 54, 72, 84, 100, 109, 130
10, 13, 23, 35, 52, 72, 89, 96, 110, 133

span 1 {1 1 1}

highlight edges

CIF datablock 1, entity 2 of 2